About 3-chloro-2-(3-chloro-2-pyridinyl)pyridine;palladium(2+)
3-chloro-2-(3-chloro-2-pyridinyl)pyridine;palladium(2+) (PubChem CID 18935247) has the molecular formula C10H6Cl2N2Pd+2
and a molecular weight of 331.50 g/mol. Its IUPAC name is 3-chloro-2-(3-chloro-2-pyridinyl)pyridine;palladium(2+).
Molecular Properties
| Compound Name | 3-chloro-2-(3-chloro-2-pyridinyl)pyridine;palladium(2+) |
| PubChem CID | 18935247 |
| Molecular Formula | C10H6Cl2N2Pd+2 |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 329.89 |
| IUPAC Name | 3-chloro-2-(3-chloro-2-pyridinyl)pyridine;palladium(2+) |
| SMILES | Clc1cccnc1-c1ncccc1Cl.[Pd+2] |
| InChI | InChI=1S/C10H6Cl2N2.Pd/c11-7-3-1-5-13-9(7)10-8(12)4-2-6-14-10;/h1-6H;/q;+2 |
| InChIKey | FKSOIJAZLIXGTQ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.50 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-chloro-2-(3-chloro-2-pyridinyl)pyridine;palladium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-2-(3-chloro-2-pyridinyl)pyridine;palladium(2+)?
The IUPAC name of 3-chloro-2-(3-chloro-2-pyridinyl)pyridine;palladium(2+) (CID 18935247) is 3-chloro-2-(3-chloro-2-pyridinyl)pyridine;palladium(2+).
What is the SMILES notation for 3-chloro-2-(3-chloro-2-pyridinyl)pyridine;palladium(2+)?
The canonical SMILES for 3-chloro-2-(3-chloro-2-pyridinyl)pyridine;palladium(2+) is Clc1cccnc1-c1ncccc1Cl.[Pd+2].
What is the InChIKey of 3-chloro-2-(3-chloro-2-pyridinyl)pyridine;palladium(2+)?
The InChIKey is FKSOIJAZLIXGTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6Cl2N2.Pd/c11-7-3-1-5-13-9(7)10-8(12)4-2-6-14-10;/h1-6H;/q;+2.
What are the key properties of 3-chloro-2-(3-chloro-2-pyridinyl)pyridine;palladium(2+)?
3-chloro-2-(3-chloro-2-pyridinyl)pyridine;palladium(2+) has a molecular weight of 331.50 g/mol, XLogP of 3.45, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2-(3-chloro-2-pyridinyl)pyridine;palladium(2+) is sourced from PubChem (CID 18935247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).