About azane;2,3-dichloropyridine
azane;2,3-dichloropyridine (PubChem CID 174689212) has the molecular formula C5H6Cl2N2
and a molecular weight of 165.02 g/mol. Its IUPAC name is azane;2,3-dichloropyridine.
Molecular Properties
| Compound Name | azane;2,3-dichloropyridine |
| PubChem CID | 174689212 |
| Molecular Formula | C5H6Cl2N2 |
| Molecular Weight | 165.02 g/mol |
| Exact Mass | 163.99 |
| IUPAC Name | azane;2,3-dichloropyridine |
| SMILES | Clc1cccnc1Cl.N |
| InChI | InChI=1S/C5H3Cl2N.H3N/c6-4-2-1-3-8-5(4)7;/h1-3H;1H3 |
| InChIKey | AJOVWFSPXKSXEL-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 47.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.02 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze azane;2,3-dichloropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2,3-dichloropyridine?
The IUPAC name of azane;2,3-dichloropyridine (CID 174689212) is azane;2,3-dichloropyridine.
What is the SMILES notation for azane;2,3-dichloropyridine?
The canonical SMILES for azane;2,3-dichloropyridine is Clc1cccnc1Cl.N.
What is the InChIKey of azane;2,3-dichloropyridine?
The InChIKey is AJOVWFSPXKSXEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3Cl2N.H3N/c6-4-2-1-3-8-5(4)7;/h1-3H;1H3.
What are the key properties of azane;2,3-dichloropyridine?
azane;2,3-dichloropyridine has a molecular weight of 165.02 g/mol, XLogP of 2.55, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2,3-dichloropyridine is sourced from PubChem (CID 174689212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).