About 2,3-dichloro-4-methylpyridine;2,3-dichloropyridine
2,3-dichloro-4-methylpyridine;2,3-dichloropyridine (PubChem CID 158187016) has the molecular formula C11H8Cl4N2
and a molecular weight of 310.01 g/mol. Its IUPAC name is 2,3-dichloro-4-methylpyridine;2,3-dichloropyridine.
Molecular Properties
| Compound Name | 2,3-dichloro-4-methylpyridine;2,3-dichloropyridine |
| PubChem CID | 158187016 |
| Molecular Formula | C11H8Cl4N2 |
| Molecular Weight | 310.01 g/mol |
| Exact Mass | 307.94 |
| IUPAC Name | 2,3-dichloro-4-methylpyridine;2,3-dichloropyridine |
| SMILES | Cc1ccnc(Cl)c1Cl.Clc1cccnc1Cl |
| InChI | InChI=1S/C6H5Cl2N.C5H3Cl2N/c1-4-2-3-9-6(8)5(4)7;6-4-2-1-3-8-5(4)7/h2-3H,1H3;1-3H |
| InChIKey | FZGNSAKQVBODSI-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.01 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dichloro-4-methylpyridine;2,3-dichloropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dichloro-4-methylpyridine;2,3-dichloropyridine?
The IUPAC name of 2,3-dichloro-4-methylpyridine;2,3-dichloropyridine (CID 158187016) is 2,3-dichloro-4-methylpyridine;2,3-dichloropyridine.
What is the SMILES notation for 2,3-dichloro-4-methylpyridine;2,3-dichloropyridine?
The canonical SMILES for 2,3-dichloro-4-methylpyridine;2,3-dichloropyridine is Cc1ccnc(Cl)c1Cl.Clc1cccnc1Cl.
What is the InChIKey of 2,3-dichloro-4-methylpyridine;2,3-dichloropyridine?
The InChIKey is FZGNSAKQVBODSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5Cl2N.C5H3Cl2N/c1-4-2-3-9-6(8)5(4)7;6-4-2-1-3-8-5(4)7/h2-3H,1H3;1-3H.
What are the key properties of 2,3-dichloro-4-methylpyridine;2,3-dichloropyridine?
2,3-dichloro-4-methylpyridine;2,3-dichloropyridine has a molecular weight of 310.01 g/mol, XLogP of 5.09, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dichloro-4-methylpyridine;2,3-dichloropyridine is sourced from PubChem (CID 158187016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).