C11H8Cl4N2 — CID 158187016
2,3-dichloro-4-methylpyridine;2,3-dichloropyridine (PubChem CID 158187016) has the molecular formula C11H8Cl4N2 and a molecular weight of 310.01 g/mol. Its IUPAC name is 2,3-dichloro-4-methylpyridine;2,3-dichloropyridine.
| Compound Name | 2,3-dichloro-4-methylpyridine;2,3-dichloropyridine |
|---|---|
| PubChem CID | 158187016 |
| Molecular Formula | C11H8Cl4N2 |
| Molecular Weight | 310.01 g/mol |
| Exact Mass | 307.94 |
| IUPAC Name | 2,3-dichloro-4-methylpyridine;2,3-dichloropyridine |
| SMILES | Cc1ccnc(Cl)c1Cl.Clc1cccnc1Cl |
| InChI | InChI=1S/C6H5Cl2N.C5H3Cl2N/c1-4-2-3-9-6(8)5(4)7;6-4-2-1-3-8-5(4)7/h2-3H,1H3;1-3H |
| InChIKey | FZGNSAKQVBODSI-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.01 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|