C13H11Cl3FN — CID 160532527
1-chloro-3-fluoro-2-methylbenzene;2,4-dichloro-3-methylpyridine (PubChem CID 160532527) has the molecular formula C13H11Cl3FN and a molecular weight of 306.60 g/mol. Its IUPAC name is 1-chloro-3-fluoro-2-methylbenzene;2,4-dichloro-3-methylpyridine.
| Compound Name | 1-chloro-3-fluoro-2-methylbenzene;2,4-dichloro-3-methylpyridine |
|---|---|
| PubChem CID | 160532527 |
| Molecular Formula | C13H11Cl3FN |
| Molecular Weight | 306.60 g/mol |
| Exact Mass | 304.99 |
| IUPAC Name | 1-chloro-3-fluoro-2-methylbenzene;2,4-dichloro-3-methylpyridine |
| SMILES | Cc1c(Cl)ccnc1Cl.Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C7H6ClF.C6H5Cl2N/c1-5-6(8)3-2-4-7(5)9;1-4-5(7)2-3-9-6(4)8/h2-4H,1H3;2-3H,1H3 |
| InChIKey | QVSSDTSBMOUEED-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.60 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|