C11H16F2 — CID 159186577
1,3-difluoro-2-methylbenzene;2-methylpropane (PubChem CID 159186577) has the molecular formula C11H16F2 and a molecular weight of 186.25 g/mol. Its IUPAC name is 1,3-difluoro-2-methylbenzene;2-methylpropane.
| Compound Name | 1,3-difluoro-2-methylbenzene;2-methylpropane |
|---|---|
| PubChem CID | 159186577 |
| Molecular Formula | C11H16F2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 1,3-difluoro-2-methylbenzene;2-methylpropane |
| SMILES | CC(C)C.Cc1c(F)cccc1F |
| InChI | InChI=1S/C7H6F2.C4H10/c1-5-6(8)3-2-4-7(5)9;1-4(2)3/h2-4H,1H3;4H,1-3H3 |
| InChIKey | KNOHOCINKJGXBM-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |