C9H10FN — CID 144500110
1-fluoro-2,3-dimethylbenzene;formonitrile (PubChem CID 144500110) has the molecular formula C9H10FN and a molecular weight of 151.18 g/mol. Its IUPAC name is 1-fluoro-2,3-dimethylbenzene;formonitrile.
| Compound Name | 1-fluoro-2,3-dimethylbenzene;formonitrile |
|---|---|
| PubChem CID | 144500110 |
| Molecular Formula | C9H10FN |
| Molecular Weight | 151.18 g/mol |
| Exact Mass | 151.08 |
| IUPAC Name | 1-fluoro-2,3-dimethylbenzene;formonitrile |
| SMILES | C#N.Cc1cccc(F)c1C |
| InChI | InChI=1S/C8H9F.CHN/c1-6-4-3-5-8(9)7(6)2;1-2/h3-5H,1-2H3;1H |
| InChIKey | YSVXBSXKWODNTH-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.18 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |