C7H6F2V — CID 170603843
1,2-difluoro-3-methylbenzene;vanadium (PubChem CID 170603843) has the molecular formula C7H6F2V and a molecular weight of 179.06 g/mol. Its IUPAC name is 1,2-difluoro-3-methylbenzene;vanadium.
| Compound Name | 1,2-difluoro-3-methylbenzene;vanadium |
|---|---|
| PubChem CID | 170603843 |
| Molecular Formula | C7H6F2V |
| Molecular Weight | 179.06 g/mol |
| Exact Mass | 178.99 |
| IUPAC Name | 1,2-difluoro-3-methylbenzene;vanadium |
| SMILES | Cc1cccc(F)c1F.[V] |
| InChI | InChI=1S/C7H6F2.V/c1-5-3-2-4-6(8)7(5)9;/h2-4H,1H3; |
| InChIKey | QKKOKVLGIRGHGG-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.06 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |