About ethane;2-fluoro-6-methylphenol
ethane;2-fluoro-6-methylphenol (PubChem CID 162729094) has the molecular formula C11H19FO
and a molecular weight of 186.27 g/mol. Its IUPAC name is ethane;2-fluoro-6-methylphenol.
Molecular Properties
| Compound Name | ethane;2-fluoro-6-methylphenol |
| PubChem CID | 162729094 |
| Molecular Formula | C11H19FO |
| Molecular Weight | 186.27 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | ethane;2-fluoro-6-methylphenol |
| SMILES | CC.CC.Cc1cccc(F)c1O |
| InChI | InChI=1S/C7H7FO.2C2H6/c1-5-3-2-4-6(8)7(5)9;2*1-2/h2-4,9H,1H3;2*1-2H3 |
| InChIKey | QZJQOUOPNOVPDC-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.27 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;2-fluoro-6-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-fluoro-6-methylphenol?
The IUPAC name of ethane;2-fluoro-6-methylphenol (CID 162729094) is ethane;2-fluoro-6-methylphenol.
What is the SMILES notation for ethane;2-fluoro-6-methylphenol?
The canonical SMILES for ethane;2-fluoro-6-methylphenol is CC.CC.Cc1cccc(F)c1O.
What is the InChIKey of ethane;2-fluoro-6-methylphenol?
The InChIKey is QZJQOUOPNOVPDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7FO.2C2H6/c1-5-3-2-4-6(8)7(5)9;2*1-2/h2-4,9H,1H3;2*1-2H3.
What are the key properties of ethane;2-fluoro-6-methylphenol?
ethane;2-fluoro-6-methylphenol has a molecular weight of 186.27 g/mol, XLogP of 3.89, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-fluoro-6-methylphenol is sourced from PubChem (CID 162729094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).