About butane;2,6-dimethylphenol;ethane
butane;2,6-dimethylphenol;ethane (PubChem CID 143018459) has the molecular formula C16H32O
and a molecular weight of 240.43 g/mol. Its IUPAC name is butane;2,6-dimethylphenol;ethane.
Molecular Properties
| Compound Name | butane;2,6-dimethylphenol;ethane |
| PubChem CID | 143018459 |
| Molecular Formula | C16H32O |
| Molecular Weight | 240.43 g/mol |
| Exact Mass | 240.25 |
| IUPAC Name | butane;2,6-dimethylphenol;ethane |
| SMILES | CC.CC.CCCC.Cc1cccc(C)c1O |
| InChI | InChI=1S/C8H10O.C4H10.2C2H6/c1-6-4-3-5-7(2)8(6)9;1-3-4-2;2*1-2/h3-5,9H,1-2H3;3-4H2,1-2H3;2*1-2H3 |
| InChIKey | PJEKNVOAPCKMFP-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 240.43 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze butane;2,6-dimethylphenol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;2,6-dimethylphenol;ethane?
The IUPAC name of butane;2,6-dimethylphenol;ethane (CID 143018459) is butane;2,6-dimethylphenol;ethane.
What is the SMILES notation for butane;2,6-dimethylphenol;ethane?
The canonical SMILES for butane;2,6-dimethylphenol;ethane is CC.CC.CCCC.Cc1cccc(C)c1O.
What is the InChIKey of butane;2,6-dimethylphenol;ethane?
The InChIKey is PJEKNVOAPCKMFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O.C4H10.2C2H6/c1-6-4-3-5-7(2)8(6)9;1-3-4-2;2*1-2/h3-5,9H,1-2H3;3-4H2,1-2H3;2*1-2H3.
What are the key properties of butane;2,6-dimethylphenol;ethane?
butane;2,6-dimethylphenol;ethane has a molecular weight of 240.43 g/mol, XLogP of 5.87, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butane;2,6-dimethylphenol;ethane is sourced from PubChem (CID 143018459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).