C15H18O4 — CID 158712110
3-ethylbenzene-1,2-diol;3-methylbenzene-1,2-diol (PubChem CID 158712110) has the molecular formula C15H18O4 and a molecular weight of 262.31 g/mol. Its IUPAC name is 3-ethylbenzene-1,2-diol;3-methylbenzene-1,2-diol.
| Compound Name | 3-ethylbenzene-1,2-diol;3-methylbenzene-1,2-diol |
|---|---|
| PubChem CID | 158712110 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 3-ethylbenzene-1,2-diol;3-methylbenzene-1,2-diol |
| SMILES | CCc1cccc(O)c1O.Cc1cccc(O)c1O |
| InChI | InChI=1S/C8H10O2.C7H8O2/c1-2-6-4-3-5-7(9)8(6)10;1-5-3-2-4-6(8)7(5)9/h3-5,9-10H,2H2,1H3;2-4,8-9H,1H3 |
| InChIKey | IIVYFVUNMNHRKS-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|