C11H18O4 — CID 174976791
butane-2,2-diol;3-methylbenzene-1,2-diol (PubChem CID 174976791) has the molecular formula C11H18O4 and a molecular weight of 214.26 g/mol. Its IUPAC name is butane-2,2-diol;3-methylbenzene-1,2-diol.
| Compound Name | butane-2,2-diol;3-methylbenzene-1,2-diol |
|---|---|
| PubChem CID | 174976791 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | butane-2,2-diol;3-methylbenzene-1,2-diol |
| SMILES | CCC(C)(O)O.Cc1cccc(O)c1O |
| InChI | InChI=1S/C7H8O2.C4H10O2/c1-5-3-2-4-6(8)7(5)9;1-3-4(2,5)6/h2-4,8-9H,1H3;5-6H,3H2,1-2H3 |
| InChIKey | JRXRBYFJDZVVLC-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|