C14H16O3 — CID 175355365
benzene-1,2,3-triol;1,2-xylene (PubChem CID 175355365) has the molecular formula C14H16O3 and a molecular weight of 232.28 g/mol. Its IUPAC name is benzene-1,2,3-triol;1,2-xylene.
| Compound Name | benzene-1,2,3-triol;1,2-xylene |
|---|---|
| PubChem CID | 175355365 |
| Molecular Formula | C14H16O3 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | benzene-1,2,3-triol;1,2-xylene |
| SMILES | Cc1ccccc1C.Oc1cccc(O)c1O |
| InChI | InChI=1S/C8H10.C6H6O3/c1-7-5-3-4-6-8(7)2;7-4-2-1-3-5(8)6(4)9/h3-6H,1-2H3;1-3,7-9H |
| InChIKey | XSHKJMXHGKWKHE-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|