C6H9BiO3 — CID 174447840
benzene-1,2,3-triol;bismuthane (PubChem CID 174447840) has the molecular formula C6H9BiO3 and a molecular weight of 338.12 g/mol. Its IUPAC name is benzene-1,2,3-triol;bismuthane.
| Compound Name | benzene-1,2,3-triol;bismuthane |
|---|---|
| PubChem CID | 174447840 |
| Molecular Formula | C6H9BiO3 |
| Molecular Weight | 338.12 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | benzene-1,2,3-triol;bismuthane |
| SMILES | Oc1cccc(O)c1O.[BiH3] |
| InChI | InChI=1S/C6H6O3.Bi.3H/c7-4-2-1-3-5(8)6(4)9;;;;/h1-3,7-9H;;;; |
| InChIKey | XAENRLZBUJRGJM-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.12 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|