C6H8O7S — CID 121350878
benzene-1,2,3-triol;sulfuric acid (PubChem CID 121350878) has the molecular formula C6H8O7S and a molecular weight of 224.19 g/mol. Its IUPAC name is benzene-1,2,3-triol;sulfuric acid.
| Compound Name | benzene-1,2,3-triol;sulfuric acid |
|---|---|
| PubChem CID | 121350878 |
| Molecular Formula | C6H8O7S |
| Molecular Weight | 224.19 g/mol |
| Exact Mass | 224.00 |
| IUPAC Name | benzene-1,2,3-triol;sulfuric acid |
| SMILES | O=S(=O)(O)O.Oc1cccc(O)c1O |
| InChI | InChI=1S/C6H6O3.H2O4S/c7-4-2-1-3-5(8)6(4)9;1-5(2,3)4/h1-3,7-9H;(H2,1,2,3,4) |
| InChIKey | IQUAOMFSKNRAOL-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.19 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|