C12H12O6 — CID 87074018
benzene-1,2,3-triol (PubChem CID 87074018) has the molecular formula C12H12O6 and a molecular weight of 252.22 g/mol. Its IUPAC name is benzene-1,2,3-triol.
| Compound Name | benzene-1,2,3-triol |
|---|---|
| PubChem CID | 87074018 |
| Molecular Formula | C12H12O6 |
| Molecular Weight | 252.22 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | benzene-1,2,3-triol |
| SMILES | Oc1cccc(O)c1O.Oc1cccc(O)c1O |
| InChI | InChI=1S/2C6H6O3/c2*7-4-2-1-3-5(8)6(4)9/h2*1-3,7-9H |
| InChIKey | OUZAIHKUAVMAKS-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.22 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|