About 3-chlorobenzene-1,2-diol;hydroiodide
3-chlorobenzene-1,2-diol;hydroiodide (PubChem CID 70006724) has the molecular formula C6H6ClIO2
and a molecular weight of 272.47 g/mol. Its IUPAC name is 3-chlorobenzene-1,2-diol;hydroiodide.
Molecular Properties
| Compound Name | 3-chlorobenzene-1,2-diol;hydroiodide |
| PubChem CID | 70006724 |
| Molecular Formula | C6H6ClIO2 |
| Molecular Weight | 272.47 g/mol |
| Exact Mass | 271.91 |
| IUPAC Name | 3-chlorobenzene-1,2-diol;hydroiodide |
| SMILES | I.Oc1cccc(Cl)c1O |
| InChI | InChI=1S/C6H5ClO2.HI/c7-4-2-1-3-5(8)6(4)9;/h1-3,8-9H;1H |
| InChIKey | YZGNJFFMRBIDLR-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.47 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-chlorobenzene-1,2-diol;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chlorobenzene-1,2-diol;hydroiodide?
The IUPAC name of 3-chlorobenzene-1,2-diol;hydroiodide (CID 70006724) is 3-chlorobenzene-1,2-diol;hydroiodide.
What is the SMILES notation for 3-chlorobenzene-1,2-diol;hydroiodide?
The canonical SMILES for 3-chlorobenzene-1,2-diol;hydroiodide is I.Oc1cccc(Cl)c1O.
What is the InChIKey of 3-chlorobenzene-1,2-diol;hydroiodide?
The InChIKey is YZGNJFFMRBIDLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5ClO2.HI/c7-4-2-1-3-5(8)6(4)9;/h1-3,8-9H;1H.
What are the key properties of 3-chlorobenzene-1,2-diol;hydroiodide?
3-chlorobenzene-1,2-diol;hydroiodide has a molecular weight of 272.47 g/mol, XLogP of 2.37, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chlorobenzene-1,2-diol;hydroiodide is sourced from PubChem (CID 70006724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).