About bis(2-chlorophenol);tungsten
bis(2-chlorophenol);tungsten (PubChem CID 88625581) has the molecular formula C12H10Cl2O2W
and a molecular weight of 440.96 g/mol. Its IUPAC name is bis(2-chlorophenol);tungsten.
Molecular Properties
| Compound Name | bis(2-chlorophenol);tungsten |
| PubChem CID | 88625581 |
| Molecular Formula | C12H10Cl2O2W |
| Molecular Weight | 440.96 g/mol |
| Exact Mass | 439.96 |
| IUPAC Name | bis(2-chlorophenol);tungsten |
| SMILES | Oc1ccccc1Cl.Oc1ccccc1Cl.[W] |
| InChI | InChI=1S/2C6H5ClO.W/c2*7-5-3-1-2-4-6(5)8;/h2*1-4,8H; |
| InChIKey | LQRHJTDUDIEJLE-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.96 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze bis(2-chlorophenol);tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-chlorophenol);tungsten?
The IUPAC name of bis(2-chlorophenol);tungsten (CID 88625581) is bis(2-chlorophenol);tungsten.
What is the SMILES notation for bis(2-chlorophenol);tungsten?
The canonical SMILES for bis(2-chlorophenol);tungsten is Oc1ccccc1Cl.Oc1ccccc1Cl.[W].
What is the InChIKey of bis(2-chlorophenol);tungsten?
The InChIKey is LQRHJTDUDIEJLE-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H5ClO.W/c2*7-5-3-1-2-4-6(5)8;/h2*1-4,8H;.
What are the key properties of bis(2-chlorophenol);tungsten?
bis(2-chlorophenol);tungsten has a molecular weight of 440.96 g/mol, XLogP of 4.09, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-chlorophenol);tungsten is sourced from PubChem (CID 88625581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).