About 2-chlorophenol;2-nitrophenol
2-chlorophenol;2-nitrophenol (PubChem CID 23467444) has the molecular formula C12H10ClNO4
and a molecular weight of 267.67 g/mol. Its IUPAC name is 2-chlorophenol;2-nitrophenol.
Molecular Properties
| Compound Name | 2-chlorophenol;2-nitrophenol |
| PubChem CID | 23467444 |
| Molecular Formula | C12H10ClNO4 |
| Molecular Weight | 267.67 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | 2-chlorophenol;2-nitrophenol |
| SMILES | O=[N+]([O-])c1ccccc1O.Oc1ccccc1Cl |
| InChI | InChI=1S/C6H5ClO.C6H5NO3/c7-5-3-1-2-4-6(5)8;8-6-4-2-1-3-5(6)7(9)10/h1-4,8H;1-4,8H |
| InChIKey | ALVWCHPZEUMGQW-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.67 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-chlorophenol;2-nitrophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chlorophenol;2-nitrophenol?
The IUPAC name of 2-chlorophenol;2-nitrophenol (CID 23467444) is 2-chlorophenol;2-nitrophenol.
What is the SMILES notation for 2-chlorophenol;2-nitrophenol?
The canonical SMILES for 2-chlorophenol;2-nitrophenol is O=[N+]([O-])c1ccccc1O.Oc1ccccc1Cl.
What is the InChIKey of 2-chlorophenol;2-nitrophenol?
The InChIKey is ALVWCHPZEUMGQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5ClO.C6H5NO3/c7-5-3-1-2-4-6(5)8;8-6-4-2-1-3-5(6)7(9)10/h1-4,8H;1-4,8H.
What are the key properties of 2-chlorophenol;2-nitrophenol?
2-chlorophenol;2-nitrophenol has a molecular weight of 267.67 g/mol, XLogP of 3.35, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chlorophenol;2-nitrophenol is sourced from PubChem (CID 23467444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).