About 1-chloro-2-nitrobenzene;methanol
1-chloro-2-nitrobenzene;methanol (PubChem CID 157371441) has the molecular formula C7H8ClNO3
and a molecular weight of 189.60 g/mol. Its IUPAC name is 1-chloro-2-nitrobenzene;methanol.
Molecular Properties
| Compound Name | 1-chloro-2-nitrobenzene;methanol |
| PubChem CID | 157371441 |
| Molecular Formula | C7H8ClNO3 |
| Molecular Weight | 189.60 g/mol |
| Exact Mass | 189.02 |
| IUPAC Name | 1-chloro-2-nitrobenzene;methanol |
| SMILES | CO.O=[N+]([O-])c1ccccc1Cl |
| InChI | InChI=1S/C6H4ClNO2.CH4O/c7-5-3-1-2-4-6(5)8(9)10;1-2/h1-4H;2H,1H3 |
| InChIKey | BJUSRVABPSDFLU-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.60 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-2-nitrobenzene;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-2-nitrobenzene;methanol?
The IUPAC name of 1-chloro-2-nitrobenzene;methanol (CID 157371441) is 1-chloro-2-nitrobenzene;methanol.
What is the SMILES notation for 1-chloro-2-nitrobenzene;methanol?
The canonical SMILES for 1-chloro-2-nitrobenzene;methanol is CO.O=[N+]([O-])c1ccccc1Cl.
What is the InChIKey of 1-chloro-2-nitrobenzene;methanol?
The InChIKey is BJUSRVABPSDFLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4ClNO2.CH4O/c7-5-3-1-2-4-6(5)8(9)10;1-2/h1-4H;2H,1H3.
What are the key properties of 1-chloro-2-nitrobenzene;methanol?
1-chloro-2-nitrobenzene;methanol has a molecular weight of 189.60 g/mol, XLogP of 1.86, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-2-nitrobenzene;methanol is sourced from PubChem (CID 157371441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).