About 1-chloro-2-nitrobenzene;1-nitro-2-(2-nitrophenyl)benzene
1-chloro-2-nitrobenzene;1-nitro-2-(2-nitrophenyl)benzene (PubChem CID 159796978) has the molecular formula C18H12ClN3O6
and a molecular weight of 401.76 g/mol. Its IUPAC name is 1-chloro-2-nitrobenzene;1-nitro-2-(2-nitrophenyl)benzene.
Molecular Properties
| Compound Name | 1-chloro-2-nitrobenzene;1-nitro-2-(2-nitrophenyl)benzene |
| PubChem CID | 159796978 |
| Molecular Formula | C18H12ClN3O6 |
| Molecular Weight | 401.76 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | 1-chloro-2-nitrobenzene;1-nitro-2-(2-nitrophenyl)benzene |
| SMILES | O=[N+]([O-])c1ccccc1-c1ccccc1[N+](=O)[O-].O=[N+]([O-])c1ccccc1Cl |
| InChI | InChI=1S/C12H8N2O4.C6H4ClNO2/c15-13(16)11-7-3-1-5-9(11)10-6-2-4-8-12(10)14(17)18;7-5-3-1-2-4-6(5)8(9)10/h1-8H;1-4H |
| InChIKey | NJHKTMLKICEEIB-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 129.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.76 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-2-nitrobenzene;1-nitro-2-(2-nitrophenyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-2-nitrobenzene;1-nitro-2-(2-nitrophenyl)benzene?
The IUPAC name of 1-chloro-2-nitrobenzene;1-nitro-2-(2-nitrophenyl)benzene (CID 159796978) is 1-chloro-2-nitrobenzene;1-nitro-2-(2-nitrophenyl)benzene.
What is the SMILES notation for 1-chloro-2-nitrobenzene;1-nitro-2-(2-nitrophenyl)benzene?
The canonical SMILES for 1-chloro-2-nitrobenzene;1-nitro-2-(2-nitrophenyl)benzene is O=[N+]([O-])c1ccccc1-c1ccccc1[N+](=O)[O-].O=[N+]([O-])c1ccccc1Cl.
What is the InChIKey of 1-chloro-2-nitrobenzene;1-nitro-2-(2-nitrophenyl)benzene?
The InChIKey is NJHKTMLKICEEIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2O4.C6H4ClNO2/c15-13(16)11-7-3-1-5-9(11)10-6-2-4-8-12(10)14(17)18;7-5-3-1-2-4-6(5)8(9)10/h1-8H;1-4H.
What are the key properties of 1-chloro-2-nitrobenzene;1-nitro-2-(2-nitrophenyl)benzene?
1-chloro-2-nitrobenzene;1-nitro-2-(2-nitrophenyl)benzene has a molecular weight of 401.76 g/mol, XLogP of 5.42, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-2-nitrobenzene;1-nitro-2-(2-nitrophenyl)benzene is sourced from PubChem (CID 159796978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).