About 1,2-dichlorobenzene;nitromethane
1,2-dichlorobenzene;nitromethane (PubChem CID 174874189) has the molecular formula C7H7Cl2NO2
and a molecular weight of 208.04 g/mol. Its IUPAC name is 1,2-dichlorobenzene;nitromethane.
Molecular Properties
| Compound Name | 1,2-dichlorobenzene;nitromethane |
| PubChem CID | 174874189 |
| Molecular Formula | C7H7Cl2NO2 |
| Molecular Weight | 208.04 g/mol |
| Exact Mass | 206.99 |
| IUPAC Name | 1,2-dichlorobenzene;nitromethane |
| SMILES | C[N+](=O)[O-].Clc1ccccc1Cl |
| InChI | InChI=1S/C6H4Cl2.CH3NO2/c7-5-3-1-2-4-6(5)8;1-2(3)4/h1-4H;1H3 |
| InChIKey | OGUYVFXLXYBZNA-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.04 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dichlorobenzene;nitromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dichlorobenzene;nitromethane?
The IUPAC name of 1,2-dichlorobenzene;nitromethane (CID 174874189) is 1,2-dichlorobenzene;nitromethane.
What is the SMILES notation for 1,2-dichlorobenzene;nitromethane?
The canonical SMILES for 1,2-dichlorobenzene;nitromethane is C[N+](=O)[O-].Clc1ccccc1Cl.
What is the InChIKey of 1,2-dichlorobenzene;nitromethane?
The InChIKey is OGUYVFXLXYBZNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4Cl2.CH3NO2/c7-5-3-1-2-4-6(5)8;1-2(3)4/h1-4H;1H3.
What are the key properties of 1,2-dichlorobenzene;nitromethane?
1,2-dichlorobenzene;nitromethane has a molecular weight of 208.04 g/mol, XLogP of 2.89, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dichlorobenzene;nitromethane is sourced from PubChem (CID 174874189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).