About 1,2-bis(bromomethyl)benzene;nitromethane
1,2-bis(bromomethyl)benzene;nitromethane (PubChem CID 160729854) has the molecular formula C9H11Br2NO2
and a molecular weight of 325.00 g/mol. Its IUPAC name is 1,2-bis(bromomethyl)benzene;nitromethane.
Molecular Properties
| Compound Name | 1,2-bis(bromomethyl)benzene;nitromethane |
| PubChem CID | 160729854 |
| Molecular Formula | C9H11Br2NO2 |
| Molecular Weight | 325.00 g/mol |
| Exact Mass | 322.92 |
| IUPAC Name | 1,2-bis(bromomethyl)benzene;nitromethane |
| SMILES | BrCc1ccccc1CBr.C[N+](=O)[O-] |
| InChI | InChI=1S/C8H8Br2.CH3NO2/c9-5-7-3-1-2-4-8(7)6-10;1-2(3)4/h1-4H,5-6H2;1H3 |
| InChIKey | RUEOQFUKCDQZEC-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.00 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,2-bis(bromomethyl)benzene;nitromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-bis(bromomethyl)benzene;nitromethane?
The IUPAC name of 1,2-bis(bromomethyl)benzene;nitromethane (CID 160729854) is 1,2-bis(bromomethyl)benzene;nitromethane.
What is the SMILES notation for 1,2-bis(bromomethyl)benzene;nitromethane?
The canonical SMILES for 1,2-bis(bromomethyl)benzene;nitromethane is BrCc1ccccc1CBr.C[N+](=O)[O-].
What is the InChIKey of 1,2-bis(bromomethyl)benzene;nitromethane?
The InChIKey is RUEOQFUKCDQZEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8Br2.CH3NO2/c9-5-7-3-1-2-4-8(7)6-10;1-2(3)4/h1-4H,5-6H2;1H3.
What are the key properties of 1,2-bis(bromomethyl)benzene;nitromethane?
1,2-bis(bromomethyl)benzene;nitromethane has a molecular weight of 325.00 g/mol, XLogP of 3.37, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-bis(bromomethyl)benzene;nitromethane is sourced from PubChem (CID 160729854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).