About benzene;nitromethane;propane
benzene;nitromethane;propane (PubChem CID 90897925) has the molecular formula C10H17NO2
and a molecular weight of 183.25 g/mol. Its IUPAC name is benzene;nitromethane;propane.
Molecular Properties
| Compound Name | benzene;nitromethane;propane |
| PubChem CID | 90897925 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | benzene;nitromethane;propane |
| SMILES | CCC.C[N+](=O)[O-].c1ccccc1 |
| InChI | InChI=1S/C6H6.C3H8.CH3NO2/c1-2-4-6-5-3-1;1-3-2;1-2(3)4/h1-6H;3H2,1-2H3;1H3 |
| InChIKey | CQBYKWHPPGZGDT-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze benzene;nitromethane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;nitromethane;propane?
The IUPAC name of benzene;nitromethane;propane (CID 90897925) is benzene;nitromethane;propane.
What is the SMILES notation for benzene;nitromethane;propane?
The canonical SMILES for benzene;nitromethane;propane is CCC.C[N+](=O)[O-].c1ccccc1.
What is the InChIKey of benzene;nitromethane;propane?
The InChIKey is CQBYKWHPPGZGDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6.C3H8.CH3NO2/c1-2-4-6-5-3-1;1-3-2;1-2(3)4/h1-6H;3H2,1-2H3;1H3.
What are the key properties of benzene;nitromethane;propane?
benzene;nitromethane;propane has a molecular weight of 183.25 g/mol, XLogP of 3.00, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;nitromethane;propane is sourced from PubChem (CID 90897925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).