About molecular nitrogen;nitromethane
molecular nitrogen;nitromethane (PubChem CID 141240049) has the molecular formula CH3N3O2
and a molecular weight of 89.05 g/mol. Its IUPAC name is molecular nitrogen;nitromethane.
Molecular Properties
| Compound Name | molecular nitrogen;nitromethane |
| PubChem CID | 141240049 |
| Molecular Formula | CH3N3O2 |
| Molecular Weight | 89.05 g/mol |
| Exact Mass | 89.02 |
| IUPAC Name | molecular nitrogen;nitromethane |
| SMILES | C[N+](=O)[O-].N#N |
| InChI | InChI=1S/CH3NO2.N2/c1-2(3)4;1-2/h1H3; |
| InChIKey | OZXMYLSTGXZNJH-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 90.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 89.05 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze molecular nitrogen;nitromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of molecular nitrogen;nitromethane?
The IUPAC name of molecular nitrogen;nitromethane (CID 141240049) is molecular nitrogen;nitromethane.
What is the SMILES notation for molecular nitrogen;nitromethane?
The canonical SMILES for molecular nitrogen;nitromethane is C[N+](=O)[O-].N#N.
What is the InChIKey of molecular nitrogen;nitromethane?
The InChIKey is OZXMYLSTGXZNJH-UHFFFAOYSA-N. The full InChI is InChI=1S/CH3NO2.N2/c1-2(3)4;1-2/h1H3;.
What are the key properties of molecular nitrogen;nitromethane?
molecular nitrogen;nitromethane has a molecular weight of 89.05 g/mol, XLogP of -0.08, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for molecular nitrogen;nitromethane is sourced from PubChem (CID 141240049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).