About 1-nitroethane;nitromethane;2-nitropropane
1-nitroethane;nitromethane;2-nitropropane (PubChem CID 162226378) has the molecular formula C6H15N3O6
and a molecular weight of 225.20 g/mol. Its IUPAC name is 1-nitroethane;nitromethane;2-nitropropane.
Molecular Properties
| Compound Name | 1-nitroethane;nitromethane;2-nitropropane |
| PubChem CID | 162226378 |
| Molecular Formula | C6H15N3O6 |
| Molecular Weight | 225.20 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 1-nitroethane;nitromethane;2-nitropropane |
| SMILES | CC(C)[N+](=O)[O-].CC[N+](=O)[O-].C[N+](=O)[O-] |
| InChI | InChI=1S/C3H7NO2.C2H5NO2.CH3NO2/c1-3(2)4(5)6;1-2-3(4)5;1-2(3)4/h3H,1-2H3;2H2,1H3;1H3 |
| InChIKey | ZUUYRXFXSSBAPN-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 129.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.20 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-nitroethane;nitromethane;2-nitropropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-nitroethane;nitromethane;2-nitropropane?
The IUPAC name of 1-nitroethane;nitromethane;2-nitropropane (CID 162226378) is 1-nitroethane;nitromethane;2-nitropropane.
What is the SMILES notation for 1-nitroethane;nitromethane;2-nitropropane?
The canonical SMILES for 1-nitroethane;nitromethane;2-nitropropane is CC(C)[N+](=O)[O-].CC[N+](=O)[O-].C[N+](=O)[O-].
What is the InChIKey of 1-nitroethane;nitromethane;2-nitropropane?
The InChIKey is ZUUYRXFXSSBAPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO2.C2H5NO2.CH3NO2/c1-3(2)4(5)6;1-2-3(4)5;1-2(3)4/h3H,1-2H3;2H2,1H3;1H3.
What are the key properties of 1-nitroethane;nitromethane;2-nitropropane?
1-nitroethane;nitromethane;2-nitropropane has a molecular weight of 225.20 g/mol, XLogP of 0.85, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-nitroethane;nitromethane;2-nitropropane is sourced from PubChem (CID 162226378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).