About methane;1-nitroethane;tetrahydrochloride
methane;1-nitroethane;tetrahydrochloride (PubChem CID 173016040) has the molecular formula C3H13Cl4NO2
and a molecular weight of 236.95 g/mol. Its IUPAC name is methane;1-nitroethane;tetrahydrochloride.
Molecular Properties
| Compound Name | methane;1-nitroethane;tetrahydrochloride |
| PubChem CID | 173016040 |
| Molecular Formula | C3H13Cl4NO2 |
| Molecular Weight | 236.95 g/mol |
| Exact Mass | 234.97 |
| IUPAC Name | methane;1-nitroethane;tetrahydrochloride |
| SMILES | C.CC[N+](=O)[O-].Cl.Cl.Cl.Cl |
| InChI | InChI=1S/C2H5NO2.CH4.4ClH/c1-2-3(4)5;;;;;/h2H2,1H3;1H4;4*1H |
| InChIKey | TUVKVHMCSIKINQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.95 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methane;1-nitroethane;tetrahydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;1-nitroethane;tetrahydrochloride?
The IUPAC name of methane;1-nitroethane;tetrahydrochloride (CID 173016040) is methane;1-nitroethane;tetrahydrochloride.
What is the SMILES notation for methane;1-nitroethane;tetrahydrochloride?
The canonical SMILES for methane;1-nitroethane;tetrahydrochloride is C.CC[N+](=O)[O-].Cl.Cl.Cl.Cl.
What is the InChIKey of methane;1-nitroethane;tetrahydrochloride?
The InChIKey is TUVKVHMCSIKINQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5NO2.CH4.4ClH/c1-2-3(4)5;;;;;/h2H2,1H3;1H4;4*1H.
What are the key properties of methane;1-nitroethane;tetrahydrochloride?
methane;1-nitroethane;tetrahydrochloride has a molecular weight of 236.95 g/mol, XLogP of 2.61, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;1-nitroethane;tetrahydrochloride is sourced from PubChem (CID 173016040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).