About ytterbium;nitrate;tetrahydrate
ytterbium;nitrate;tetrahydrate (PubChem CID 18185938) has the molecular formula H8NO7Yb-
and a molecular weight of 307.10 g/mol. Its IUPAC name is ytterbium;nitrate;tetrahydrate.
Molecular Properties
| Compound Name | ytterbium;nitrate;tetrahydrate |
| PubChem CID | 18185938 |
| Molecular Formula | H8NO7Yb- |
| Molecular Weight | 307.10 g/mol |
| Exact Mass | 307.97 |
| IUPAC Name | ytterbium;nitrate;tetrahydrate |
| SMILES | O.O.O.O.O=[N+]([O-])[O-].[Yb] |
| InChI | InChI=1S/NO3.4H2O.Yb/c2-1(3)4;;;;;/h;4*1H2;/q-1;;;;; |
| InChIKey | NKMWLILHRQDPID-UHFFFAOYSA-N |
| XLogP | -3.54 |
| TPSA | 192.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.10 |
| LogP ≤ 5 | -3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ytterbium;nitrate;tetrahydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ytterbium;nitrate;tetrahydrate?
The IUPAC name of ytterbium;nitrate;tetrahydrate (CID 18185938) is ytterbium;nitrate;tetrahydrate.
What is the SMILES notation for ytterbium;nitrate;tetrahydrate?
The canonical SMILES for ytterbium;nitrate;tetrahydrate is O.O.O.O.O=[N+]([O-])[O-].[Yb].
What is the InChIKey of ytterbium;nitrate;tetrahydrate?
The InChIKey is NKMWLILHRQDPID-UHFFFAOYSA-N. The full InChI is InChI=1S/NO3.4H2O.Yb/c2-1(3)4;;;;;/h;4*1H2;/q-1;;;;;.
What are the key properties of ytterbium;nitrate;tetrahydrate?
ytterbium;nitrate;tetrahydrate has a molecular weight of 307.10 g/mol, XLogP of -3.54, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ytterbium;nitrate;tetrahydrate is sourced from PubChem (CID 18185938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).