About sodium;nitrate;tetrahydrate
sodium;nitrate;tetrahydrate (PubChem CID 162201136) has the molecular formula H8NNaO7
and a molecular weight of 157.05 g/mol. Its IUPAC name is sodium;nitrate;tetrahydrate.
Molecular Properties
| Compound Name | sodium;nitrate;tetrahydrate |
| PubChem CID | 162201136 |
| Molecular Formula | H8NNaO7 |
| Molecular Weight | 157.05 g/mol |
| Exact Mass | 157.02 |
| IUPAC Name | sodium;nitrate;tetrahydrate |
| SMILES | O.O.O.O.O=[N+]([O-])[O-].[Na+] |
| InChI | InChI=1S/NO3.Na.4H2O/c2-1(3)4;;;;;/h;;4*1H2/q-1;+1;;;; |
| InChIKey | ZRPDBPDPHQSNMO-UHFFFAOYSA-N |
| XLogP | -6.53 |
| TPSA | 192.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.05 |
| LogP ≤ 5 | -6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze sodium;nitrate;tetrahydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;nitrate;tetrahydrate?
The IUPAC name of sodium;nitrate;tetrahydrate (CID 162201136) is sodium;nitrate;tetrahydrate.
What is the SMILES notation for sodium;nitrate;tetrahydrate?
The canonical SMILES for sodium;nitrate;tetrahydrate is O.O.O.O.O=[N+]([O-])[O-].[Na+].
What is the InChIKey of sodium;nitrate;tetrahydrate?
The InChIKey is ZRPDBPDPHQSNMO-UHFFFAOYSA-N. The full InChI is InChI=1S/NO3.Na.4H2O/c2-1(3)4;;;;;/h;;4*1H2/q-1;+1;;;;.
What are the key properties of sodium;nitrate;tetrahydrate?
sodium;nitrate;tetrahydrate has a molecular weight of 157.05 g/mol, XLogP of -6.53, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;nitrate;tetrahydrate is sourced from PubChem (CID 162201136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).