About sodium;nitrate;decahydrate
sodium;nitrate;decahydrate (PubChem CID 163206513) has the molecular formula H20NNaO13
and a molecular weight of 265.14 g/mol. Its IUPAC name is sodium;nitrate;decahydrate.
Molecular Properties
| Compound Name | sodium;nitrate;decahydrate |
| PubChem CID | 163206513 |
| Molecular Formula | H20NNaO13 |
| Molecular Weight | 265.14 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | sodium;nitrate;decahydrate |
| SMILES | O.O.O.O.O.O.O.O.O.O.O=[N+]([O-])[O-].[Na+] |
| InChI | InChI=1S/NO3.Na.10H2O/c2-1(3)4;;;;;;;;;;;/h;;10*1H2/q-1;+1;;;;;;;;;; |
| InChIKey | PBLJOBXJDQHOTQ-UHFFFAOYSA-N |
| XLogP | -11.48 |
| TPSA | 381.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.14 |
| LogP ≤ 5 | -11.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze sodium;nitrate;decahydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;nitrate;decahydrate?
The IUPAC name of sodium;nitrate;decahydrate (CID 163206513) is sodium;nitrate;decahydrate.
What is the SMILES notation for sodium;nitrate;decahydrate?
The canonical SMILES for sodium;nitrate;decahydrate is O.O.O.O.O.O.O.O.O.O.O=[N+]([O-])[O-].[Na+].
What is the InChIKey of sodium;nitrate;decahydrate?
The InChIKey is PBLJOBXJDQHOTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/NO3.Na.10H2O/c2-1(3)4;;;;;;;;;;;/h;;10*1H2/q-1;+1;;;;;;;;;;.
What are the key properties of sodium;nitrate;decahydrate?
sodium;nitrate;decahydrate has a molecular weight of 265.14 g/mol, XLogP of -11.48, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;nitrate;decahydrate is sourced from PubChem (CID 163206513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).