About 1-nitro(113C)ethane
1-nitro(113C)ethane (PubChem CID 71309579) has the molecular formula C2H5NO2
and a molecular weight of 76.06 g/mol. Its IUPAC name is 1-nitro(113C)ethane.
Molecular Properties
| Compound Name | 1-nitro(113C)ethane |
| PubChem CID | 71309579 |
| Molecular Formula | C2H5NO2 |
| Molecular Weight | 76.06 g/mol |
| Exact Mass | 76.04 |
| IUPAC Name | 1-nitro(113C)ethane |
| SMILES | C[13CH2][N+](=O)[O-] |
| InChI | InChI=1S/C2H5NO2/c1-2-3(4)5/h2H2,1H3/i2+1 |
| InChIKey | MCSAJNNLRCFZED-VQEHIDDOSA-N |
| XLogP | 0.28 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 76.06 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-nitro(113C)ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-nitro(113C)ethane?
The IUPAC name of 1-nitro(113C)ethane (CID 71309579) is 1-nitro(113C)ethane.
What is the SMILES notation for 1-nitro(113C)ethane?
The canonical SMILES for 1-nitro(113C)ethane is C[13CH2][N+](=O)[O-].
What is the InChIKey of 1-nitro(113C)ethane?
The InChIKey is MCSAJNNLRCFZED-VQEHIDDOSA-N. The full InChI is InChI=1S/C2H5NO2/c1-2-3(4)5/h2H2,1H3/i2+1.
What are the key properties of 1-nitro(113C)ethane?
1-nitro(113C)ethane has a molecular weight of 76.06 g/mol, XLogP of 0.28, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-nitro(113C)ethane is sourced from PubChem (CID 71309579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).