About CID 20695325
CID 20695325 (PubChem CID 20695325) has the molecular formula CH2BNO2
and a molecular weight of 70.84 g/mol.
Molecular Properties
| Compound Name | CID 20695325 |
| PubChem CID | 20695325 |
| Molecular Formula | CH2BNO2 |
| Molecular Weight | 70.84 g/mol |
| Exact Mass | 71.02 |
| IUPAC Name | — |
| SMILES | [B]C[N+](=O)[O-] |
| InChI | InChI=1S/CH2BNO2/c2-1-3(4)5/h1H2 |
| InChIKey | HEYPAKYMBTZBAI-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 70.84 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 20695325 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 20695325?
The IUPAC name of CID 20695325 (CID 20695325) is not available.
What is the SMILES notation for CID 20695325?
The canonical SMILES for CID 20695325 is [B]C[N+](=O)[O-].
What is the InChIKey of CID 20695325?
The InChIKey is HEYPAKYMBTZBAI-UHFFFAOYSA-N. The full InChI is InChI=1S/CH2BNO2/c2-1-3(4)5/h1H2.
What are the key properties of CID 20695325?
CID 20695325 has a molecular weight of 70.84 g/mol, XLogP of -0.61, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 20695325 is sourced from PubChem (CID 20695325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).