About 1,13-dinitrotridecane
1,13-dinitrotridecane (PubChem CID 19902714) has the molecular formula C13H26N2O4
and a molecular weight of 274.36 g/mol. Its IUPAC name is 1,13-dinitrotridecane.
Molecular Properties
| Compound Name | 1,13-dinitrotridecane |
| PubChem CID | 19902714 |
| Molecular Formula | C13H26N2O4 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | 1,13-dinitrotridecane |
| SMILES | O=[N+]([O-])CCCCCCCCCCCCC[N+](=O)[O-] |
| InChI | InChI=1S/C13H26N2O4/c16-14(17)12-10-8-6-4-2-1-3-5-7-9-11-13-15(18)19/h1-13H2 |
| InChIKey | QPJHYIHVZITHIH-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,13-dinitrotridecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,13-dinitrotridecane?
The IUPAC name of 1,13-dinitrotridecane (CID 19902714) is 1,13-dinitrotridecane.
What is the SMILES notation for 1,13-dinitrotridecane?
The canonical SMILES for 1,13-dinitrotridecane is O=[N+]([O-])CCCCCCCCCCCCC[N+](=O)[O-].
What is the InChIKey of 1,13-dinitrotridecane?
The InChIKey is QPJHYIHVZITHIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2O4/c16-14(17)12-10-8-6-4-2-1-3-5-7-9-11-13-15(18)19/h1-13H2.
What are the key properties of 1,13-dinitrotridecane?
1,13-dinitrotridecane has a molecular weight of 274.36 g/mol, XLogP of 3.83, 14 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,13-dinitrotridecane is sourced from PubChem (CID 19902714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).