About 5-nitropentan-1-amine
5-nitropentan-1-amine (PubChem CID 18987841) has the molecular formula C5H12N2O2
and a molecular weight of 132.16 g/mol. Its IUPAC name is 5-nitropentan-1-amine.
Molecular Properties
| Compound Name | 5-nitropentan-1-amine |
| PubChem CID | 18987841 |
| Molecular Formula | C5H12N2O2 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.09 |
| IUPAC Name | 5-nitropentan-1-amine |
| SMILES | NCCCCC[N+](=O)[O-] |
| InChI | InChI=1S/C5H12N2O2/c6-4-2-1-3-5-7(8)9/h1-6H2 |
| InChIKey | FXBNMXOJAIGPKI-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-nitropentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitropentan-1-amine?
The IUPAC name of 5-nitropentan-1-amine (CID 18987841) is 5-nitropentan-1-amine.
What is the SMILES notation for 5-nitropentan-1-amine?
The canonical SMILES for 5-nitropentan-1-amine is NCCCCC[N+](=O)[O-].
What is the InChIKey of 5-nitropentan-1-amine?
The InChIKey is FXBNMXOJAIGPKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2O2/c6-4-2-1-3-5-7(8)9/h1-6H2.
What are the key properties of 5-nitropentan-1-amine?
5-nitropentan-1-amine has a molecular weight of 132.16 g/mol, XLogP of 0.39, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitropentan-1-amine is sourced from PubChem (CID 18987841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).