About 1-iodo-6-nitrohexane
1-iodo-6-nitrohexane (PubChem CID 86202424) has the molecular formula C6H12INO2
and a molecular weight of 257.07 g/mol. Its IUPAC name is 1-iodo-6-nitrohexane.
Molecular Properties
| Compound Name | 1-iodo-6-nitrohexane |
| PubChem CID | 86202424 |
| Molecular Formula | C6H12INO2 |
| Molecular Weight | 257.07 g/mol |
| Exact Mass | 256.99 |
| IUPAC Name | 1-iodo-6-nitrohexane |
| SMILES | O=[N+]([O-])CCCCCCI |
| InChI | InChI=1S/C6H12INO2/c7-5-3-1-2-4-6-8(9)10/h1-6H2 |
| InChIKey | RWNOXUTZOFSOKV-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.07 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-iodo-6-nitrohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-iodo-6-nitrohexane?
The IUPAC name of 1-iodo-6-nitrohexane (CID 86202424) is 1-iodo-6-nitrohexane.
What is the SMILES notation for 1-iodo-6-nitrohexane?
The canonical SMILES for 1-iodo-6-nitrohexane is O=[N+]([O-])CCCCCCI.
What is the InChIKey of 1-iodo-6-nitrohexane?
The InChIKey is RWNOXUTZOFSOKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12INO2/c7-5-3-1-2-4-6-8(9)10/h1-6H2.
What are the key properties of 1-iodo-6-nitrohexane?
1-iodo-6-nitrohexane has a molecular weight of 257.07 g/mol, XLogP of 2.26, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-iodo-6-nitrohexane is sourced from PubChem (CID 86202424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).