About 9-nitroheptadecane;6-nitropentadecane;1-nitrotridecane
9-nitroheptadecane;6-nitropentadecane;1-nitrotridecane (PubChem CID 87201342) has the molecular formula C45H93N3O6
and a molecular weight of 772.25 g/mol. Its IUPAC name is 9-nitroheptadecane;6-nitropentadecane;1-nitrotridecane.
Molecular Properties
| Compound Name | 9-nitroheptadecane;6-nitropentadecane;1-nitrotridecane |
| PubChem CID | 87201342 |
| Molecular Formula | C45H93N3O6 |
| Molecular Weight | 772.25 g/mol |
| Exact Mass | 771.71 |
| IUPAC Name | 9-nitroheptadecane;6-nitropentadecane;1-nitrotridecane |
| SMILES | CCCCCCCCC(CCCCCCCC)[N+](=O)[O-].CCCCCCCCCC(CCCCC)[N+](=O)[O-].CCCCCCCCCCCCC[N+](=O)[O-] |
| InChI | InChI=1S/C17H35NO2.C15H31NO2.C13H27NO2/c1-3-5-7-9-11-13-15-17(18(19)20)16-14-12-10-8-6-4-2;1-3-5-7-8-9-10-12-14-15(16(17)18)13-11-6-4-2;1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h17H,3-16H2,1-2H3;15H,3-14H2,1-2H3;2-13H2,1H3 |
| InChIKey | HSXQOBTWATXYKS-UHFFFAOYSA-N |
| XLogP | 16.06 |
| TPSA | 129.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 54 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 772.25 |
| LogP ≤ 5 | 16.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 9-nitroheptadecane;6-nitropentadecane;1-nitrotridecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-nitroheptadecane;6-nitropentadecane;1-nitrotridecane?
The IUPAC name of 9-nitroheptadecane;6-nitropentadecane;1-nitrotridecane (CID 87201342) is 9-nitroheptadecane;6-nitropentadecane;1-nitrotridecane.
What is the SMILES notation for 9-nitroheptadecane;6-nitropentadecane;1-nitrotridecane?
The canonical SMILES for 9-nitroheptadecane;6-nitropentadecane;1-nitrotridecane is CCCCCCCCC(CCCCCCCC)[N+](=O)[O-].CCCCCCCCCC(CCCCC)[N+](=O)[O-].CCCCCCCCCCCCC[N+](=O)[O-].
What is the InChIKey of 9-nitroheptadecane;6-nitropentadecane;1-nitrotridecane?
The InChIKey is HSXQOBTWATXYKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H35NO2.C15H31NO2.C13H27NO2/c1-3-5-7-9-11-13-15-17(18(19)20)16-14-12-10-8-6-4-2;1-3-5-7-8-9-10-12-14-15(16(17)18)13-11-6-4-2;1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h17H,3-16H2,1-2H3;15H,3-14H2,1-2H3;2-13H2,1H3.
What are the key properties of 9-nitroheptadecane;6-nitropentadecane;1-nitrotridecane?
9-nitroheptadecane;6-nitropentadecane;1-nitrotridecane has a molecular weight of 772.25 g/mol, XLogP of 16.06, 40 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 9-nitroheptadecane;6-nitropentadecane;1-nitrotridecane is sourced from PubChem (CID 87201342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).