About 2-nitrohexane;4-nitrononane;5-nitroundecane
2-nitrohexane;4-nitrononane;5-nitroundecane (PubChem CID 87201330) has the molecular formula C26H55N3O6
and a molecular weight of 505.74 g/mol. Its IUPAC name is 2-nitrohexane;4-nitrononane;5-nitroundecane.
Molecular Properties
| Compound Name | 2-nitrohexane;4-nitrononane;5-nitroundecane |
| PubChem CID | 87201330 |
| Molecular Formula | C26H55N3O6 |
| Molecular Weight | 505.74 g/mol |
| Exact Mass | 505.41 |
| IUPAC Name | 2-nitrohexane;4-nitrononane;5-nitroundecane |
| SMILES | CCCCC(C)[N+](=O)[O-].CCCCCC(CCC)[N+](=O)[O-].CCCCCCC(CCCC)[N+](=O)[O-] |
| InChI | InChI=1S/C11H23NO2.C9H19NO2.C6H13NO2/c1-3-5-7-8-10-11(12(13)14)9-6-4-2;1-3-5-6-8-9(7-4-2)10(11)12;1-3-4-5-6(2)7(8)9/h11H,3-10H2,1-2H3;9H,3-8H2,1-2H3;6H,3-5H2,1-2H3 |
| InChIKey | FCBHMKNBWPTMON-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 129.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 505.74 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-nitrohexane;4-nitrononane;5-nitroundecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitrohexane;4-nitrononane;5-nitroundecane?
The IUPAC name of 2-nitrohexane;4-nitrononane;5-nitroundecane (CID 87201330) is 2-nitrohexane;4-nitrononane;5-nitroundecane.
What is the SMILES notation for 2-nitrohexane;4-nitrononane;5-nitroundecane?
The canonical SMILES for 2-nitrohexane;4-nitrononane;5-nitroundecane is CCCCC(C)[N+](=O)[O-].CCCCCC(CCC)[N+](=O)[O-].CCCCCCC(CCCC)[N+](=O)[O-].
What is the InChIKey of 2-nitrohexane;4-nitrononane;5-nitroundecane?
The InChIKey is FCBHMKNBWPTMON-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO2.C9H19NO2.C6H13NO2/c1-3-5-7-8-10-11(12(13)14)9-6-4-2;1-3-5-6-8-9(7-4-2)10(11)12;1-3-4-5-6(2)7(8)9/h11H,3-10H2,1-2H3;9H,3-8H2,1-2H3;6H,3-5H2,1-2H3.
What are the key properties of 2-nitrohexane;4-nitrononane;5-nitroundecane?
2-nitrohexane;4-nitrononane;5-nitroundecane has a molecular weight of 505.74 g/mol, XLogP of 8.65, 20 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitrohexane;4-nitrononane;5-nitroundecane is sourced from PubChem (CID 87201330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).