About 1-nitroheptane;5-nitrononane;6-nitroundecane
1-nitroheptane;5-nitrononane;6-nitroundecane (PubChem CID 87201345) has the molecular formula C27H57N3O6
and a molecular weight of 519.77 g/mol. Its IUPAC name is 1-nitroheptane;5-nitrononane;6-nitroundecane.
Molecular Properties
| Compound Name | 1-nitroheptane;5-nitrononane;6-nitroundecane |
| PubChem CID | 87201345 |
| Molecular Formula | C27H57N3O6 |
| Molecular Weight | 519.77 g/mol |
| Exact Mass | 519.42 |
| IUPAC Name | 1-nitroheptane;5-nitrononane;6-nitroundecane |
| SMILES | CCCCC(CCCC)[N+](=O)[O-].CCCCCC(CCCCC)[N+](=O)[O-].CCCCCCC[N+](=O)[O-] |
| InChI | InChI=1S/C11H23NO2.C9H19NO2.C7H15NO2/c1-3-5-7-9-11(12(13)14)10-8-6-4-2;1-3-5-7-9(10(11)12)8-6-4-2;1-2-3-4-5-6-7-8(9)10/h11H,3-10H2,1-2H3;9H,3-8H2,1-2H3;2-7H2,1H3 |
| InChIKey | AWZPEDCAZDXQDK-UHFFFAOYSA-N |
| XLogP | 9.04 |
| TPSA | 129.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 519.77 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-nitroheptane;5-nitrononane;6-nitroundecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-nitroheptane;5-nitrononane;6-nitroundecane?
The IUPAC name of 1-nitroheptane;5-nitrononane;6-nitroundecane (CID 87201345) is 1-nitroheptane;5-nitrononane;6-nitroundecane.
What is the SMILES notation for 1-nitroheptane;5-nitrononane;6-nitroundecane?
The canonical SMILES for 1-nitroheptane;5-nitrononane;6-nitroundecane is CCCCC(CCCC)[N+](=O)[O-].CCCCCC(CCCCC)[N+](=O)[O-].CCCCCCC[N+](=O)[O-].
What is the InChIKey of 1-nitroheptane;5-nitrononane;6-nitroundecane?
The InChIKey is AWZPEDCAZDXQDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO2.C9H19NO2.C7H15NO2/c1-3-5-7-9-11(12(13)14)10-8-6-4-2;1-3-5-7-9(10(11)12)8-6-4-2;1-2-3-4-5-6-7-8(9)10/h11H,3-10H2,1-2H3;9H,3-8H2,1-2H3;2-7H2,1H3.
What are the key properties of 1-nitroheptane;5-nitrononane;6-nitroundecane?
1-nitroheptane;5-nitrononane;6-nitroundecane has a molecular weight of 519.77 g/mol, XLogP of 9.04, 22 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-nitroheptane;5-nitrononane;6-nitroundecane is sourced from PubChem (CID 87201345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).