About 2-nitrohexadecane;4-nitrooctadecane;5-nitrotridecane
2-nitrohexadecane;4-nitrooctadecane;5-nitrotridecane (PubChem CID 87201243) has the molecular formula C47H97N3O6
and a molecular weight of 800.31 g/mol. Its IUPAC name is 2-nitrohexadecane;4-nitrooctadecane;5-nitrotridecane.
Molecular Properties
| Compound Name | 2-nitrohexadecane;4-nitrooctadecane;5-nitrotridecane |
| PubChem CID | 87201243 |
| Molecular Formula | C47H97N3O6 |
| Molecular Weight | 800.31 g/mol |
| Exact Mass | 799.74 |
| IUPAC Name | 2-nitrohexadecane;4-nitrooctadecane;5-nitrotridecane |
| SMILES | CCCCCCCCC(CCCC)[N+](=O)[O-].CCCCCCCCCCCCCCC(C)[N+](=O)[O-].CCCCCCCCCCCCCCC(CCC)[N+](=O)[O-] |
| InChI | InChI=1S/C18H37NO2.C16H33NO2.C13H27NO2/c1-3-5-6-7-8-9-10-11-12-13-14-15-17-18(16-4-2)19(20)21;1-3-4-5-6-7-8-9-10-11-12-13-14-15-16(2)17(18)19;1-3-5-7-8-9-10-12-13(14(15)16)11-6-4-2/h18H,3-17H2,1-2H3;16H,3-15H2,1-2H3;13H,3-12H2,1-2H3 |
| InChIKey | KBBBXFVMFKMABS-UHFFFAOYSA-N |
| XLogP | 16.84 |
| TPSA | 129.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 56 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 800.31 |
| LogP ≤ 5 | 16.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-nitrohexadecane;4-nitrooctadecane;5-nitrotridecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitrohexadecane;4-nitrooctadecane;5-nitrotridecane?
The IUPAC name of 2-nitrohexadecane;4-nitrooctadecane;5-nitrotridecane (CID 87201243) is 2-nitrohexadecane;4-nitrooctadecane;5-nitrotridecane.
What is the SMILES notation for 2-nitrohexadecane;4-nitrooctadecane;5-nitrotridecane?
The canonical SMILES for 2-nitrohexadecane;4-nitrooctadecane;5-nitrotridecane is CCCCCCCCC(CCCC)[N+](=O)[O-].CCCCCCCCCCCCCCC(C)[N+](=O)[O-].CCCCCCCCCCCCCCC(CCC)[N+](=O)[O-].
What is the InChIKey of 2-nitrohexadecane;4-nitrooctadecane;5-nitrotridecane?
The InChIKey is KBBBXFVMFKMABS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H37NO2.C16H33NO2.C13H27NO2/c1-3-5-6-7-8-9-10-11-12-13-14-15-17-18(16-4-2)19(20)21;1-3-4-5-6-7-8-9-10-11-12-13-14-15-16(2)17(18)19;1-3-5-7-8-9-10-12-13(14(15)16)11-6-4-2/h18H,3-17H2,1-2H3;16H,3-15H2,1-2H3;13H,3-12H2,1-2H3.
What are the key properties of 2-nitrohexadecane;4-nitrooctadecane;5-nitrotridecane?
2-nitrohexadecane;4-nitrooctadecane;5-nitrotridecane has a molecular weight of 800.31 g/mol, XLogP of 16.84, 41 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitrohexadecane;4-nitrooctadecane;5-nitrotridecane is sourced from PubChem (CID 87201243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).