About 2,4-dinitropentadecane
2,4-dinitropentadecane (PubChem CID 163361803) has the molecular formula C15H30N2O4
and a molecular weight of 302.42 g/mol. Its IUPAC name is 2,4-dinitropentadecane.
Molecular Properties
| Compound Name | 2,4-dinitropentadecane |
| PubChem CID | 163361803 |
| Molecular Formula | C15H30N2O4 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | 2,4-dinitropentadecane |
| SMILES | CCCCCCCCCCCC(CC(C)[N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C15H30N2O4/c1-3-4-5-6-7-8-9-10-11-12-15(17(20)21)13-14(2)16(18)19/h14-15H,3-13H2,1-2H3 |
| InChIKey | GIJSMKPZIKUAOK-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dinitropentadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dinitropentadecane?
The IUPAC name of 2,4-dinitropentadecane (CID 163361803) is 2,4-dinitropentadecane.
What is the SMILES notation for 2,4-dinitropentadecane?
The canonical SMILES for 2,4-dinitropentadecane is CCCCCCCCCCCC(CC(C)[N+](=O)[O-])[N+](=O)[O-].
What is the InChIKey of 2,4-dinitropentadecane?
The InChIKey is GIJSMKPZIKUAOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30N2O4/c1-3-4-5-6-7-8-9-10-11-12-15(17(20)21)13-14(2)16(18)19/h14-15H,3-13H2,1-2H3.
What are the key properties of 2,4-dinitropentadecane?
2,4-dinitropentadecane has a molecular weight of 302.42 g/mol, XLogP of 4.61, 14 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dinitropentadecane is sourced from PubChem (CID 163361803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).