About 7-nitrohexadecane
7-nitrohexadecane (PubChem CID 87201115) has the molecular formula C16H33NO2
and a molecular weight of 271.44 g/mol. Its IUPAC name is 7-nitrohexadecane.
Molecular Properties
| Compound Name | 7-nitrohexadecane |
| PubChem CID | 87201115 |
| Molecular Formula | C16H33NO2 |
| Molecular Weight | 271.44 g/mol |
| Exact Mass | 271.25 |
| IUPAC Name | 7-nitrohexadecane |
| SMILES | CCCCCCCCCC(CCCCCC)[N+](=O)[O-] |
| InChI | InChI=1S/C16H33NO2/c1-3-5-7-9-10-11-13-15-16(17(18)19)14-12-8-6-4-2/h16H,3-15H2,1-2H3 |
| InChIKey | VSGXBWMWGLBZPT-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 271.44 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-nitrohexadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-nitrohexadecane?
The IUPAC name of 7-nitrohexadecane (CID 87201115) is 7-nitrohexadecane.
What is the SMILES notation for 7-nitrohexadecane?
The canonical SMILES for 7-nitrohexadecane is CCCCCCCCCC(CCCCCC)[N+](=O)[O-].
What is the InChIKey of 7-nitrohexadecane?
The InChIKey is VSGXBWMWGLBZPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H33NO2/c1-3-5-7-9-10-11-13-15-16(17(18)19)14-12-8-6-4-2/h16H,3-15H2,1-2H3.
What are the key properties of 7-nitrohexadecane?
7-nitrohexadecane has a molecular weight of 271.44 g/mol, XLogP of 5.74, 14 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-nitrohexadecane is sourced from PubChem (CID 87201115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).