About 9-nitrooctadecane
9-nitrooctadecane (PubChem CID 87201118) has the molecular formula C18H37NO2
and a molecular weight of 299.50 g/mol. Its IUPAC name is 9-nitrooctadecane.
Molecular Properties
| Compound Name | 9-nitrooctadecane |
| PubChem CID | 87201118 |
| Molecular Formula | C18H37NO2 |
| Molecular Weight | 299.50 g/mol |
| Exact Mass | 299.28 |
| IUPAC Name | 9-nitrooctadecane |
| SMILES | CCCCCCCCCC(CCCCCCCC)[N+](=O)[O-] |
| InChI | InChI=1S/C18H37NO2/c1-3-5-7-9-11-13-15-17-18(19(20)21)16-14-12-10-8-6-4-2/h18H,3-17H2,1-2H3 |
| InChIKey | PFCQMBQFHKYBAI-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 299.50 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 9-nitrooctadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-nitrooctadecane?
The IUPAC name of 9-nitrooctadecane (CID 87201118) is 9-nitrooctadecane.
What is the SMILES notation for 9-nitrooctadecane?
The canonical SMILES for 9-nitrooctadecane is CCCCCCCCCC(CCCCCCCC)[N+](=O)[O-].
What is the InChIKey of 9-nitrooctadecane?
The InChIKey is PFCQMBQFHKYBAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H37NO2/c1-3-5-7-9-11-13-15-17-18(19(20)21)16-14-12-10-8-6-4-2/h18H,3-17H2,1-2H3.
What are the key properties of 9-nitrooctadecane?
9-nitrooctadecane has a molecular weight of 299.50 g/mol, XLogP of 6.52, 16 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-nitrooctadecane is sourced from PubChem (CID 87201118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).