C20H42N4O4 — CID 139685395
N,N'-bis(2-nitroheptyl)hexane-1,6-diamine (PubChem CID 139685395) has the molecular formula C20H42N4O4 and a molecular weight of 402.58 g/mol. Its IUPAC name is N,N'-bis(2-nitroheptyl)hexane-1,6-diamine.
| Compound Name | N,N'-bis(2-nitroheptyl)hexane-1,6-diamine |
|---|---|
| PubChem CID | 139685395 |
| Molecular Formula | C20H42N4O4 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.32 |
| IUPAC Name | N,N'-bis(2-nitroheptyl)hexane-1,6-diamine |
| SMILES | CCCCCC(CNCCCCCCNCC(CCCCC)[N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C20H42N4O4/c1-3-5-9-13-19(23(25)26)17-21-15-11-7-8-12-16-22-18-20(24(27)28)14-10-6-4-2/h19-22H,3-18H2,1-2H3 |
| InChIKey | YDTGXSMJEYRJNU-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 110.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|