About 6-nitrododecane
6-nitrododecane (PubChem CID 11095997) has the molecular formula C12H25NO2
and a molecular weight of 215.34 g/mol. Its IUPAC name is 6-nitrododecane.
Molecular Properties
| Compound Name | 6-nitrododecane |
| PubChem CID | 11095997 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | 6-nitrododecane |
| SMILES | CCCCCCC(CCCCC)[N+](=O)[O-] |
| InChI | InChI=1S/C12H25NO2/c1-3-5-7-9-11-12(13(14)15)10-8-6-4-2/h12H,3-11H2,1-2H3 |
| InChIKey | GTIJODIXINDAGO-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-nitrododecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-nitrododecane?
The IUPAC name of 6-nitrododecane (CID 11095997) is 6-nitrododecane.
What is the SMILES notation for 6-nitrododecane?
The canonical SMILES for 6-nitrododecane is CCCCCCC(CCCCC)[N+](=O)[O-].
What is the InChIKey of 6-nitrododecane?
The InChIKey is GTIJODIXINDAGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO2/c1-3-5-7-9-11-12(13(14)15)10-8-6-4-2/h12H,3-11H2,1-2H3.
What are the key properties of 6-nitrododecane?
6-nitrododecane has a molecular weight of 215.34 g/mol, XLogP of 4.18, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-nitrododecane is sourced from PubChem (CID 11095997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).