About 17-nitroheptadecanal
17-nitroheptadecanal (PubChem CID 173492180) has the molecular formula C17H33NO3
and a molecular weight of 299.46 g/mol. Its IUPAC name is 17-nitroheptadecanal.
Molecular Properties
| Compound Name | 17-nitroheptadecanal |
| PubChem CID | 173492180 |
| Molecular Formula | C17H33NO3 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.25 |
| IUPAC Name | 17-nitroheptadecanal |
| SMILES | O=CCCCCCCCCCCCCCCCC[N+](=O)[O-] |
| InChI | InChI=1S/C17H33NO3/c19-17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18(20)21/h17H,1-16H2 |
| InChIKey | LQTZMEINYNUQLQ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 17-nitroheptadecanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 17-nitroheptadecanal?
The IUPAC name of 17-nitroheptadecanal (CID 173492180) is 17-nitroheptadecanal.
What is the SMILES notation for 17-nitroheptadecanal?
The canonical SMILES for 17-nitroheptadecanal is O=CCCCCCCCCCCCCCCCC[N+](=O)[O-].
What is the InChIKey of 17-nitroheptadecanal?
The InChIKey is LQTZMEINYNUQLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H33NO3/c19-17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18(20)21/h17H,1-16H2.
What are the key properties of 17-nitroheptadecanal?
17-nitroheptadecanal has a molecular weight of 299.46 g/mol, XLogP of 5.31, 17 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 17-nitroheptadecanal is sourced from PubChem (CID 173492180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).