About 8-nitroocta-1,3-diene
8-nitroocta-1,3-diene (PubChem CID 71320522) has the molecular formula C8H13NO2
and a molecular weight of 155.20 g/mol. Its IUPAC name is 8-nitroocta-1,3-diene.
Molecular Properties
| Compound Name | 8-nitroocta-1,3-diene |
| PubChem CID | 71320522 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | 8-nitroocta-1,3-diene |
| SMILES | C=CC=CCCCC[N+](=O)[O-] |
| InChI | InChI=1S/C8H13NO2/c1-2-3-4-5-6-7-8-9(10)11/h2-4H,1,5-8H2 |
| InChIKey | SHRUXPDMPVTLJG-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 8-nitroocta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-nitroocta-1,3-diene?
The IUPAC name of 8-nitroocta-1,3-diene (CID 71320522) is 8-nitroocta-1,3-diene.
What is the SMILES notation for 8-nitroocta-1,3-diene?
The canonical SMILES for 8-nitroocta-1,3-diene is C=CC=CCCCC[N+](=O)[O-].
What is the InChIKey of 8-nitroocta-1,3-diene?
The InChIKey is SHRUXPDMPVTLJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO2/c1-2-3-4-5-6-7-8-9(10)11/h2-4H,1,5-8H2.
What are the key properties of 8-nitroocta-1,3-diene?
8-nitroocta-1,3-diene has a molecular weight of 155.20 g/mol, XLogP of 2.18, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-nitroocta-1,3-diene is sourced from PubChem (CID 71320522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).