C20H33NO2 — CID 22344840
(5E,8E,11E,14E)-1-nitroicosa-5,8,11,14-tetraene (PubChem CID 22344840) has the molecular formula C20H33NO2 and a molecular weight of 319.49 g/mol. Its IUPAC name is (5E,8E,11E,14E)-1-nitroicosa-5,8,11,14-tetraene.
| Compound Name | (5E,8E,11E,14E)-1-nitroicosa-5,8,11,14-tetraene |
|---|---|
| PubChem CID | 22344840 |
| Molecular Formula | C20H33NO2 |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.25 |
| IUPAC Name | (5E,8E,11E,14E)-1-nitroicosa-5,8,11,14-tetraene |
| SMILES | CCCCC/C=C/C/C=C/C/C=C/C/C=C/CCCC[N+](=O)[O-] |
| InChI | InChI=1S/C20H33NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(22)23/h6-7,9-10,12-13,15-16H,2-5,8,11,14,17-20H2,1H3/b7-6+,10-9+,13-12+,16-15+ |
| InChIKey | CGPPLWASXYMPON-CGRWFSSPSA-N |
| XLogP | 6.41 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|