C22H32N2O5 — CID 173492286
2,2-dinitrodocosa-4,7,10,13,16-pentaenal (PubChem CID 173492286) has the molecular formula C22H32N2O5 and a molecular weight of 404.51 g/mol. Its IUPAC name is 2,2-dinitrodocosa-4,7,10,13,16-pentaenal.
| Compound Name | 2,2-dinitrodocosa-4,7,10,13,16-pentaenal |
|---|---|
| PubChem CID | 173492286 |
| Molecular Formula | C22H32N2O5 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | 2,2-dinitrodocosa-4,7,10,13,16-pentaenal |
| SMILES | CCCCCC=CCC=CCC=CCC=CCC=CCC(C=O)([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C22H32N2O5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22(21-25,23(26)27)24(28)29/h6-7,9-10,12-13,15-16,18-19,21H,2-5,8,11,14,17,20H2,1H3 |
| InChIKey | MZMWYYAJJAOQSL-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 103.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|