C21H35NO3 — CID 22344850
(6E,9E,12E,15E)-1-nitrohenicosa-6,9,12,15-tetraen-2-ol (PubChem CID 22344850) has the molecular formula C21H35NO3 and a molecular weight of 349.52 g/mol. Its IUPAC name is (6E,9E,12E,15E)-1-nitrohenicosa-6,9,12,15-tetraen-2-ol.
| Compound Name | (6E,9E,12E,15E)-1-nitrohenicosa-6,9,12,15-tetraen-2-ol |
|---|---|
| PubChem CID | 22344850 |
| Molecular Formula | C21H35NO3 |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.26 |
| IUPAC Name | (6E,9E,12E,15E)-1-nitrohenicosa-6,9,12,15-tetraen-2-ol |
| SMILES | CCCCC/C=C/C/C=C/C/C=C/C/C=C/CCCC(O)C[N+](=O)[O-] |
| InChI | InChI=1S/C21H35NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-21(23)20-22(24)25/h6-7,9-10,12-13,15-16,21,23H,2-5,8,11,14,17-20H2,1H3/b7-6+,10-9+,13-12+,16-15+ |
| InChIKey | WYTIHWRAOPFSCR-CGRWFSSPSA-N |
| XLogP | 5.77 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|