C23H38O3 — CID 72505843
4-hydroxytricosa-8,11,14,17-tetraenoic acid (PubChem CID 72505843) has the molecular formula C23H38O3 and a molecular weight of 362.55 g/mol. Its IUPAC name is 4-hydroxytricosa-8,11,14,17-tetraenoic acid.
| Compound Name | 4-hydroxytricosa-8,11,14,17-tetraenoic acid |
|---|---|
| PubChem CID | 72505843 |
| Molecular Formula | C23H38O3 |
| Molecular Weight | 362.55 g/mol |
| Exact Mass | 362.28 |
| IUPAC Name | 4-hydroxytricosa-8,11,14,17-tetraenoic acid |
| SMILES | CCCCCC=CCC=CCC=CCC=CCCCC(O)CCC(=O)O |
| InChI | InChI=1S/C23H38O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22(24)20-21-23(25)26/h6-7,9-10,12-13,15-16,22,24H,2-5,8,11,14,17-21H2,1H3,(H,25,26) |
| InChIKey | XRGZUJMVHCAKST-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.55 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|