10-hydroxytetracosa-12,15-dienoic acid

C24H44O3 — CID 169276974

IUPAC10-hydroxytetracosa-12,15-dienoic acid
SMILESCCCCCCCCC=CCC=CCC(O)CCCCCCCCC(=O)O
InChIInChI=1S/C24H44O3/c1-2-3-4-5-6-7-8-9-10-11-14-17-20-23(25)21-18-15-12-13-16-19-22-24(26)27/h9-10,14,17,23,25H,2-8,11-13,15-16,18-22H2,1H3,(H,26,27)
InChIKeyFOEMVEAMPQQKNR-UHFFFAOYSA-N
MW380.61 g/mol
LogP7.20
Rot. Bonds20

About 10-hydroxytetracosa-12,15-dienoic acid

10-hydroxytetracosa-12,15-dienoic acid (PubChem CID 169276974) has the molecular formula C24H44O3 and a molecular weight of 380.61 g/mol. Its IUPAC name is 10-hydroxytetracosa-12,15-dienoic acid.

Molecular Properties

Compound Name10-hydroxytetracosa-12,15-dienoic acid
PubChem CID169276974
Molecular FormulaC24H44O3
Molecular Weight380.61 g/mol
Exact Mass380.33
IUPAC Name10-hydroxytetracosa-12,15-dienoic acid
SMILESCCCCCCCCC=CCC=CCC(O)CCCCCCCCC(=O)O
InChIInChI=1S/C24H44O3/c1-2-3-4-5-6-7-8-9-10-11-14-17-20-23(25)21-18-15-12-13-16-19-22-24(26)27/h9-10,14,17,23,25H,2-8,11-13,15-16,18-22H2,1H3,(H,26,27)
InChIKeyFOEMVEAMPQQKNR-UHFFFAOYSA-N
XLogP7.20
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds20
Heavy Atoms27
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500380.61
LogP ≤ 57.20
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 10-hydroxytetracosa-12,15-dienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 10-hydroxytetracosa-12,15-dienoic acid?
The IUPAC name of 10-hydroxytetracosa-12,15-dienoic acid (CID 169276974) is 10-hydroxytetracosa-12,15-dienoic acid.
What is the SMILES notation for 10-hydroxytetracosa-12,15-dienoic acid?
The canonical SMILES for 10-hydroxytetracosa-12,15-dienoic acid is CCCCCCCCC=CCC=CCC(O)CCCCCCCCC(=O)O.
What is the InChIKey of 10-hydroxytetracosa-12,15-dienoic acid?
The InChIKey is FOEMVEAMPQQKNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H44O3/c1-2-3-4-5-6-7-8-9-10-11-14-17-20-23(25)21-18-15-12-13-16-19-22-24(26)27/h9-10,14,17,23,25H,2-8,11-13,15-16,18-22H2,1H3,(H,26,27).
What are the key properties of 10-hydroxytetracosa-12,15-dienoic acid?
10-hydroxytetracosa-12,15-dienoic acid has a molecular weight of 380.61 g/mol, XLogP of 7.20, 20 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10-hydroxytetracosa-12,15-dienoic acid is sourced from PubChem (CID 169276974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).