C24H44O3 — CID 169276974
10-hydroxytetracosa-12,15-dienoic acid (PubChem CID 169276974) has the molecular formula C24H44O3 and a molecular weight of 380.61 g/mol. Its IUPAC name is 10-hydroxytetracosa-12,15-dienoic acid.
| Compound Name | 10-hydroxytetracosa-12,15-dienoic acid |
|---|---|
| PubChem CID | 169276974 |
| Molecular Formula | C24H44O3 |
| Molecular Weight | 380.61 g/mol |
| Exact Mass | 380.33 |
| IUPAC Name | 10-hydroxytetracosa-12,15-dienoic acid |
| SMILES | CCCCCCCCC=CCC=CCC(O)CCCCCCCCC(=O)O |
| InChI | InChI=1S/C24H44O3/c1-2-3-4-5-6-7-8-9-10-11-14-17-20-23(25)21-18-15-12-13-16-19-22-24(26)27/h9-10,14,17,23,25H,2-8,11-13,15-16,18-22H2,1H3,(H,26,27) |
| InChIKey | FOEMVEAMPQQKNR-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.61 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|